About (1R)-1-ethyl-1,3,4,4-tetramethylimidazolidin-1-ium
(1R)-1-ethyl-1,3,4,4-tetramethylimidazolidin-1-ium (PubChem CID 162290101) has the molecular formula C9H21N2+
and a molecular weight of 157.28 g/mol. Its IUPAC name is (1R)-1-ethyl-1,3,4,4-tetramethylimidazolidin-1-ium.
Molecular Properties
| Compound Name | (1R)-1-ethyl-1,3,4,4-tetramethylimidazolidin-1-ium |
| PubChem CID | 162290101 |
| Molecular Formula | C9H21N2+ |
| Molecular Weight | 157.28 g/mol |
| Exact Mass | 157.17 |
| IUPAC Name | (1R)-1-ethyl-1,3,4,4-tetramethylimidazolidin-1-ium |
| SMILES | CC[N@@+]1(C)CN(C)C(C)(C)C1 |
| InChI | InChI=1S/C9H21N2/c1-6-11(5)7-9(2,3)10(4)8-11/h6-8H2,1-5H3/q+1/t11-/m1/s1 |
| InChIKey | SOIZDLAPJDUFDB-LLVKDONJSA-N |
| XLogP | 1.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (1R)-1-ethyl-1,3,4,4-tetramethylimidazolidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-ethyl-1,3,4,4-tetramethylimidazolidin-1-ium?
The IUPAC name of (1R)-1-ethyl-1,3,4,4-tetramethylimidazolidin-1-ium (CID 162290101) is (1R)-1-ethyl-1,3,4,4-tetramethylimidazolidin-1-ium.
What is the SMILES notation for (1R)-1-ethyl-1,3,4,4-tetramethylimidazolidin-1-ium?
The canonical SMILES for (1R)-1-ethyl-1,3,4,4-tetramethylimidazolidin-1-ium is CC[N@@+]1(C)CN(C)C(C)(C)C1.
What is the InChIKey of (1R)-1-ethyl-1,3,4,4-tetramethylimidazolidin-1-ium?
The InChIKey is SOIZDLAPJDUFDB-LLVKDONJSA-N. The full InChI is InChI=1S/C9H21N2/c1-6-11(5)7-9(2,3)10(4)8-11/h6-8H2,1-5H3/q+1/t11-/m1/s1.
What are the key properties of (1R)-1-ethyl-1,3,4,4-tetramethylimidazolidin-1-ium?
(1R)-1-ethyl-1,3,4,4-tetramethylimidazolidin-1-ium has a molecular weight of 157.28 g/mol, XLogP of 1.13, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-ethyl-1,3,4,4-tetramethylimidazolidin-1-ium is sourced from PubChem (CID 162290101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).