C9H21N2+ — CID 162290101
(1R)-1-ethyl-1,3,4,4-tetramethylimidazolidin-1-ium (PubChem CID 162290101) has the molecular formula C9H21N2+ and a molecular weight of 157.28 g/mol. Its IUPAC name is (1R)-1-ethyl-1,3,4,4-tetramethylimidazolidin-1-ium.
| Compound Name | (1R)-1-ethyl-1,3,4,4-tetramethylimidazolidin-1-ium |
|---|---|
| PubChem CID | 162290101 |
| Molecular Formula | C9H21N2+ |
| Molecular Weight | 157.28 g/mol |
| Exact Mass | 157.17 |
| IUPAC Name | (1R)-1-ethyl-1,3,4,4-tetramethylimidazolidin-1-ium |
| SMILES | CC[N@@+]1(C)CN(C)C(C)(C)C1 |
| InChI | InChI=1S/C9H21N2/c1-6-11(5)7-9(2,3)10(4)8-11/h6-8H2,1-5H3/q+1/t11-/m1/s1 |
| InChIKey | SOIZDLAPJDUFDB-LLVKDONJSA-N |
| XLogP | 1.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|