C15H30O9S3 — CID 162292806
(3-ethylcyclopentyl)methanesulfonic acid;[3-(trioxidanylsulfanylmethyl)cyclopentyl]methanesulfonic acid (PubChem CID 162292806) has the molecular formula C15H30O9S3 and a molecular weight of 450.60 g/mol. Its IUPAC name is (3-ethylcyclopentyl)methanesulfonic acid;[3-(trioxidanylsulfanylmethyl)cyclopentyl]methanesulfonic acid.
| Compound Name | (3-ethylcyclopentyl)methanesulfonic acid;[3-(trioxidanylsulfanylmethyl)cyclopentyl]methanesulfonic acid |
|---|---|
| PubChem CID | 162292806 |
| Molecular Formula | C15H30O9S3 |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | (3-ethylcyclopentyl)methanesulfonic acid;[3-(trioxidanylsulfanylmethyl)cyclopentyl]methanesulfonic acid |
| SMILES | CCC1CCC(CS(=O)(=O)O)C1.O=S(=O)(O)CC1CCC(CSOOO)C1 |
| InChI | InChI=1S/C8H16O3S.C7H14O6S2/c1-2-7-3-4-8(5-7)6-12(9,10)11;8-12-13-14-4-6-1-2-7(3-6)5-15(9,10)11/h7-8H,2-6H2,1H3,(H,9,10,11);6-8H,1-5H2,(H,9,10,11) |
| InChIKey | CGFOHRDJBDMVKQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|