C24H28N4O3S — CID 162300903
2-[[[5-oxo-6-[4-(sulfinoamino)phenyl]hexyl]-(pyridin-2-ylmethyl)amino]methyl]pyridine (PubChem CID 162300903) has the molecular formula C24H28N4O3S and a molecular weight of 452.58 g/mol. Its IUPAC name is 2-[[[5-oxo-6-[4-(sulfinoamino)phenyl]hexyl]-(pyridin-2-ylmethyl)amino]methyl]pyridine.
| Compound Name | 2-[[[5-oxo-6-[4-(sulfinoamino)phenyl]hexyl]-(pyridin-2-ylmethyl)amino]methyl]pyridine |
|---|---|
| PubChem CID | 162300903 |
| Molecular Formula | C24H28N4O3S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 2-[[[5-oxo-6-[4-(sulfinoamino)phenyl]hexyl]-(pyridin-2-ylmethyl)amino]methyl]pyridine |
| SMILES | O=C(CCCCN(Cc1ccccn1)Cc1ccccn1)Cc1ccc(NS(=O)O)cc1 |
| InChI | InChI=1S/C24H28N4O3S/c29-24(17-20-10-12-21(13-11-20)27-32(30)31)9-3-6-16-28(18-22-7-1-4-14-25-22)19-23-8-2-5-15-26-23/h1-2,4-5,7-8,10-15,27H,3,6,9,16-19H2,(H,30,31) |
| InChIKey | AEPDDTVFSKXRMJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|