C25H27F3N6O6 — CID 162319769
methyl 2-(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)oxy-2-phenylacetate;2,2,2-trifluoroacetic acid (PubChem CID 162319769) has the molecular formula C25H27F3N6O6 and a molecular weight of 564.52 g/mol. Its IUPAC name is methyl 2-(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)oxy-2-phenylacetate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl 2-(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)oxy-2-phenylacetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 162319769 |
| Molecular Formula | C25H27F3N6O6 |
| Molecular Weight | 564.52 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | methyl 2-(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)oxy-2-phenylacetate;2,2,2-trifluoroacetic acid |
| SMILES | CC#CCn1c(N2CCNCC2)nc2nc(OC(C(=O)OC)c3ccccc3)n(C)c(=O)c21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H26N6O4.C2HF3O2/c1-4-5-13-29-17-19(25-22(29)28-14-11-24-12-15-28)26-23(27(2)20(17)30)33-18(21(31)32-3)16-9-7-6-8-10-16;3-2(4,5)1(6)7/h6-10,18,24H,11-15H2,1-3H3;(H,6,7) |
| InChIKey | VNXUSIJKLKOHEL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 140.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.52 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|