About N'-(6,6-dichlorohexyl)methanediimine;hydrochloride
N'-(6,6-dichlorohexyl)methanediimine;hydrochloride (PubChem CID 162330492) has the molecular formula C7H13Cl3N2
and a molecular weight of 231.55 g/mol. Its IUPAC name is N'-(6,6-dichlorohexyl)methanediimine;hydrochloride.
Molecular Properties
| Compound Name | N'-(6,6-dichlorohexyl)methanediimine;hydrochloride |
| PubChem CID | 162330492 |
| Molecular Formula | C7H13Cl3N2 |
| Molecular Weight | 231.55 g/mol |
| Exact Mass | 230.01 |
| IUPAC Name | N'-(6,6-dichlorohexyl)methanediimine;hydrochloride |
| SMILES | Cl.N=C=NCCCCCC(Cl)Cl |
| InChI | InChI=1S/C7H12Cl2N2.ClH/c8-7(9)4-2-1-3-5-11-6-10;/h7,10H,1-5H2;1H |
| InChIKey | OCOIWRBQFWEHPW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.55 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N'-(6,6-dichlorohexyl)methanediimine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(6,6-dichlorohexyl)methanediimine;hydrochloride?
The IUPAC name of N'-(6,6-dichlorohexyl)methanediimine;hydrochloride (CID 162330492) is N'-(6,6-dichlorohexyl)methanediimine;hydrochloride.
What is the SMILES notation for N'-(6,6-dichlorohexyl)methanediimine;hydrochloride?
The canonical SMILES for N'-(6,6-dichlorohexyl)methanediimine;hydrochloride is Cl.N=C=NCCCCCC(Cl)Cl.
What is the InChIKey of N'-(6,6-dichlorohexyl)methanediimine;hydrochloride?
The InChIKey is OCOIWRBQFWEHPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12Cl2N2.ClH/c8-7(9)4-2-1-3-5-11-6-10;/h7,10H,1-5H2;1H.
What are the key properties of N'-(6,6-dichlorohexyl)methanediimine;hydrochloride?
N'-(6,6-dichlorohexyl)methanediimine;hydrochloride has a molecular weight of 231.55 g/mol, XLogP of 3.52, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(6,6-dichlorohexyl)methanediimine;hydrochloride is sourced from PubChem (CID 162330492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).