C8H10Cl2F2N2O2 — CID 162344224
(2R)-2-amino-3-(2,6-difluoro-3-pyridinyl)propanoic acid;dihydrochloride (PubChem CID 162344224) has the molecular formula C8H10Cl2F2N2O2 and a molecular weight of 275.08 g/mol. Its IUPAC name is (2R)-2-amino-3-(2,6-difluoro-3-pyridinyl)propanoic acid;dihydrochloride.
| Compound Name | (2R)-2-amino-3-(2,6-difluoro-3-pyridinyl)propanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 162344224 |
| Molecular Formula | C8H10Cl2F2N2O2 |
| Molecular Weight | 275.08 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | (2R)-2-amino-3-(2,6-difluoro-3-pyridinyl)propanoic acid;dihydrochloride |
| SMILES | Cl.Cl.N[C@H](Cc1ccc(F)nc1F)C(=O)O |
| InChI | InChI=1S/C8H8F2N2O2.2ClH/c9-6-2-1-4(7(10)12-6)3-5(11)8(13)14;;/h1-2,5H,3,11H2,(H,13,14);2*1H/t5-;;/m1../s1 |
| InChIKey | GUPISBMKOGYUBE-ZJIMSODOSA-N |
| XLogP | 1.16 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.08 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|