C16H14ClNO3 — CID 162345531
(4S)-6-chloro-4-methoxy-1-methyl-4-phenyl-3,1-benzoxazin-2-one (PubChem CID 162345531) has the molecular formula C16H14ClNO3 and a molecular weight of 303.75 g/mol. Its IUPAC name is (4S)-6-chloro-4-methoxy-1-methyl-4-phenyl-3,1-benzoxazin-2-one.
| Compound Name | (4S)-6-chloro-4-methoxy-1-methyl-4-phenyl-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 162345531 |
| Molecular Formula | C16H14ClNO3 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | (4S)-6-chloro-4-methoxy-1-methyl-4-phenyl-3,1-benzoxazin-2-one |
| SMILES | CO[C@@]1(c2ccccc2)OC(=O)N(C)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C16H14ClNO3/c1-18-14-9-8-12(17)10-13(14)16(20-2,21-15(18)19)11-6-4-3-5-7-11/h3-10H,1-2H3/t16-/m0/s1 |
| InChIKey | UGRLCMIRQWCAIP-INIZCTEOSA-N |
| XLogP | 3.77 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |