C18H26N2O2 — CID 162346442
2-(2-tert-butylpyrazol-3-yl)-5-pentylbenzene-1,3-diol (PubChem CID 162346442) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-(2-tert-butylpyrazol-3-yl)-5-pentylbenzene-1,3-diol.
| Compound Name | 2-(2-tert-butylpyrazol-3-yl)-5-pentylbenzene-1,3-diol |
|---|---|
| PubChem CID | 162346442 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 2-(2-tert-butylpyrazol-3-yl)-5-pentylbenzene-1,3-diol |
| SMILES | CCCCCc1cc(O)c(-c2ccnn2C(C)(C)C)c(O)c1 |
| InChI | InChI=1S/C18H26N2O2/c1-5-6-7-8-13-11-15(21)17(16(22)12-13)14-9-10-19-20(14)18(2,3)4/h9-12,21-22H,5-8H2,1-4H3 |
| InChIKey | OYFOSAGRFNLEQK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|