C21H28O5 — CID 169442102
4-(2,6-dihydroxy-4-pentylphenyl)-5-(2-hydroxypropan-2-yl)-2-methylbenzene-1,3-diol (PubChem CID 169442102) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is 4-(2,6-dihydroxy-4-pentylphenyl)-5-(2-hydroxypropan-2-yl)-2-methylbenzene-1,3-diol.
| Compound Name | 4-(2,6-dihydroxy-4-pentylphenyl)-5-(2-hydroxypropan-2-yl)-2-methylbenzene-1,3-diol |
|---|---|
| PubChem CID | 169442102 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 4-(2,6-dihydroxy-4-pentylphenyl)-5-(2-hydroxypropan-2-yl)-2-methylbenzene-1,3-diol |
| SMILES | CCCCCc1cc(O)c(-c2c(C(C)(C)O)cc(O)c(C)c2O)c(O)c1 |
| InChI | InChI=1S/C21H28O5/c1-5-6-7-8-13-9-16(23)19(17(24)10-13)18-14(21(3,4)26)11-15(22)12(2)20(18)25/h9-11,22-26H,5-8H2,1-4H3 |
| InChIKey | KQJWMNAWCUHVTN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|