C19H20FNO — CID 162351718
(3R,5S)-5-(4-fluorophenyl)-6,6-dimethyl-3-phenylpiperidin-2-one (PubChem CID 162351718) has the molecular formula C19H20FNO and a molecular weight of 297.37 g/mol. Its IUPAC name is (3R,5S)-5-(4-fluorophenyl)-6,6-dimethyl-3-phenylpiperidin-2-one.
| Compound Name | (3R,5S)-5-(4-fluorophenyl)-6,6-dimethyl-3-phenylpiperidin-2-one |
|---|---|
| PubChem CID | 162351718 |
| Molecular Formula | C19H20FNO |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | (3R,5S)-5-(4-fluorophenyl)-6,6-dimethyl-3-phenylpiperidin-2-one |
| SMILES | CC1(C)NC(=O)[C@@H](c2ccccc2)C[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C19H20FNO/c1-19(2)17(14-8-10-15(20)11-9-14)12-16(18(22)21-19)13-6-4-3-5-7-13/h3-11,16-17H,12H2,1-2H3,(H,21,22)/t16-,17+/m1/s1 |
| InChIKey | FSXBQZKSTALWBP-SJORKVTESA-N |
| XLogP | 3.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |