C30H41NO8 — CID 162356757
2,2-dimethylbutanal;3-[4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-3-methylphenyl]pyrano[2,3-c]pyridin-2-one (PubChem CID 162356757) has the molecular formula C30H41NO8 and a molecular weight of 543.66 g/mol. Its IUPAC name is 2,2-dimethylbutanal;3-[4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-3-methylphenyl]pyrano[2,3-c]pyridin-2-one.
| Compound Name | 2,2-dimethylbutanal;3-[4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-3-methylphenyl]pyrano[2,3-c]pyridin-2-one |
|---|---|
| PubChem CID | 162356757 |
| Molecular Formula | C30H41NO8 |
| Molecular Weight | 543.66 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | 2,2-dimethylbutanal;3-[4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-3-methylphenyl]pyrano[2,3-c]pyridin-2-one |
| SMILES | CCC(C)(C)C=O.COCCOCCOCCOCCOc1ccc(-c2cc3ccncc3oc2=O)cc1C |
| InChI | InChI=1S/C24H29NO7.C6H12O/c1-18-15-19(21-16-20-5-6-25-17-23(20)32-24(21)26)3-4-22(18)31-14-13-30-12-11-29-10-9-28-8-7-27-2;1-4-6(2,3)5-7/h3-6,15-17H,7-14H2,1-2H3;5H,4H2,1-3H3 |
| InChIKey | RADJBLDCCNKZHP-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 106.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.66 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|