C13H11N5O4 — CID 162357188
(Z)-2-cyano-3-hydroxy-N-(5-methoxypyrazin-2-yl)-3-(5-methyl-1,2-oxazol-4-yl)prop-2-enamide (PubChem CID 162357188) has the molecular formula C13H11N5O4 and a molecular weight of 301.26 g/mol. Its IUPAC name is (Z)-2-cyano-3-hydroxy-N-(5-methoxypyrazin-2-yl)-3-(5-methyl-1,2-oxazol-4-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-hydroxy-N-(5-methoxypyrazin-2-yl)-3-(5-methyl-1,2-oxazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 162357188 |
| Molecular Formula | C13H11N5O4 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | (Z)-2-cyano-3-hydroxy-N-(5-methoxypyrazin-2-yl)-3-(5-methyl-1,2-oxazol-4-yl)prop-2-enamide |
| SMILES | COc1cnc(NC(=O)/C(C#N)=C(\O)c2cnoc2C)cn1 |
| InChI | InChI=1S/C13H11N5O4/c1-7-9(4-17-22-7)12(19)8(3-14)13(20)18-10-5-16-11(21-2)6-15-10/h4-6,19H,1-2H3,(H,15,18,20)/b12-8- |
| InChIKey | ZTYDCLXWFVNRGL-WQLSENKSSA-N |
| XLogP | 1.21 |
| TPSA | 134.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|