C25H20BrF3N2O4 — CID 162357785
N-(6-bromo-1,2,3,4-tetrahydronaphthalen-1-yl)-7-[3-(trifluoromethyl)phenoxy]-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine-8-carboxamide (PubChem CID 162357785) has the molecular formula C25H20BrF3N2O4 and a molecular weight of 549.34 g/mol. Its IUPAC name is N-(6-bromo-1,2,3,4-tetrahydronaphthalen-1-yl)-7-[3-(trifluoromethyl)phenoxy]-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine-8-carboxamide.
| Compound Name | N-(6-bromo-1,2,3,4-tetrahydronaphthalen-1-yl)-7-[3-(trifluoromethyl)phenoxy]-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine-8-carboxamide |
|---|---|
| PubChem CID | 162357785 |
| Molecular Formula | C25H20BrF3N2O4 |
| Molecular Weight | 549.34 g/mol |
| Exact Mass | 548.06 |
| IUPAC Name | N-(6-bromo-1,2,3,4-tetrahydronaphthalen-1-yl)-7-[3-(trifluoromethyl)phenoxy]-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine-8-carboxamide |
| SMILES | O=C(NC1CCCc2cc(Br)ccc21)c1c(Oc2cccc(C(F)(F)F)c2)cnc2c1OCCO2 |
| InChI | InChI=1S/C25H20BrF3N2O4/c26-16-7-8-18-14(11-16)3-1-6-19(18)31-23(32)21-20(13-30-24-22(21)33-9-10-34-24)35-17-5-2-4-15(12-17)25(27,28)29/h2,4-5,7-8,11-13,19H,1,3,6,9-10H2,(H,31,32) |
| InChIKey | XRRFWPWGPMBOIY-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.34 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |