C5H11NOS — CID 162358806
N,3-dimethyl-1-oxothietan-3-amine (PubChem CID 162358806) has the molecular formula C5H11NOS and a molecular weight of 133.22 g/mol. Its IUPAC name is N,3-dimethyl-1-oxothietan-3-amine.
| Compound Name | N,3-dimethyl-1-oxothietan-3-amine |
|---|---|
| PubChem CID | 162358806 |
| Molecular Formula | C5H11NOS |
| Molecular Weight | 133.22 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | N,3-dimethyl-1-oxothietan-3-amine |
| SMILES | CNC1(C)CS(=O)C1 |
| InChI | InChI=1S/C5H11NOS/c1-5(6-2)3-8(7)4-5/h6H,3-4H2,1-2H3 |
| InChIKey | BICKRCIBTBQFBA-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.22 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |