C7H16N2 — CID 59704389
(3R)-1-methanidyl-N,3-dimethylpyrrolidin-1-ium-3-amine (PubChem CID 59704389) has the molecular formula C7H16N2 and a molecular weight of 128.22 g/mol. Its IUPAC name is (3R)-1-methanidyl-N,3-dimethylpyrrolidin-1-ium-3-amine.
| Compound Name | (3R)-1-methanidyl-N,3-dimethylpyrrolidin-1-ium-3-amine |
|---|---|
| PubChem CID | 59704389 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | (3R)-1-methanidyl-N,3-dimethylpyrrolidin-1-ium-3-amine |
| SMILES | [CH2-][NH+]1CC[C@@](C)(NC)C1 |
| InChI | InChI=1S/C7H16N2/c1-7(8-2)4-5-9(3)6-7/h8-9H,3-6H2,1-2H3/t7-/m1/s1 |
| InChIKey | OECIPSYNVJSEMW-SSDOTTSWSA-N |
| XLogP | -0.96 |
| TPSA | 16.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|