C32H39NS — CID 162373773
1-[2-[1-(4-cyclopentylhexyl)-4-phenylcyclohexa-2,4-dien-1-yl]ethyl]-4-isothiocyanatobenzene (PubChem CID 162373773) has the molecular formula C32H39NS and a molecular weight of 469.74 g/mol. Its IUPAC name is 1-[2-[1-(4-cyclopentylhexyl)-4-phenylcyclohexa-2,4-dien-1-yl]ethyl]-4-isothiocyanatobenzene.
| Compound Name | 1-[2-[1-(4-cyclopentylhexyl)-4-phenylcyclohexa-2,4-dien-1-yl]ethyl]-4-isothiocyanatobenzene |
|---|---|
| PubChem CID | 162373773 |
| Molecular Formula | C32H39NS |
| Molecular Weight | 469.74 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | 1-[2-[1-(4-cyclopentylhexyl)-4-phenylcyclohexa-2,4-dien-1-yl]ethyl]-4-isothiocyanatobenzene |
| SMILES | CCC(CCCC1(CCc2ccc(N=C=S)cc2)C=CC(c2ccccc2)=CC1)C1CCCC1 |
| InChI | InChI=1S/C32H39NS/c1-2-27(28-11-6-7-12-28)13-8-21-32(22-18-26-14-16-31(17-15-26)33-25-34)23-19-30(20-24-32)29-9-4-3-5-10-29/h3-5,9-10,14-17,19-20,23,27-28H,2,6-8,11-13,18,21-22,24H2,1H3 |
| InChIKey | AWCOMEYJGHVJKO-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.74 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|