C16H24N4O4 — CID 162375289
tert-butyl (2R,6S)-4-(2-formyl-6-oxo-1H-pyrimidin-4-yl)-2,6-dimethylpiperazine-1-carboxylate (PubChem CID 162375289) has the molecular formula C16H24N4O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is tert-butyl (2R,6S)-4-(2-formyl-6-oxo-1H-pyrimidin-4-yl)-2,6-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R,6S)-4-(2-formyl-6-oxo-1H-pyrimidin-4-yl)-2,6-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 162375289 |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | tert-butyl (2R,6S)-4-(2-formyl-6-oxo-1H-pyrimidin-4-yl)-2,6-dimethylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(c2cc(=O)[nH]c(C=O)n2)C[C@H](C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H24N4O4/c1-10-7-19(13-6-14(22)18-12(9-21)17-13)8-11(2)20(10)15(23)24-16(3,4)5/h6,9-11H,7-8H2,1-5H3,(H,17,18,22)/t10-,11+ |
| InChIKey | ISMVWRSCCABLGH-PHIMTYICSA-N |
| XLogP | 1.42 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|