C9H13HoN2S- — CID 162375794
holmium;4-methyl-6,7-dihydro-5H-1-benzothiophen-4-ide-2,3-diamine (PubChem CID 162375794) has the molecular formula C9H13HoN2S- and a molecular weight of 346.21 g/mol. Its IUPAC name is holmium;4-methyl-6,7-dihydro-5H-1-benzothiophen-4-ide-2,3-diamine.
| Compound Name | holmium;4-methyl-6,7-dihydro-5H-1-benzothiophen-4-ide-2,3-diamine |
|---|---|
| PubChem CID | 162375794 |
| Molecular Formula | C9H13HoN2S- |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | holmium;4-methyl-6,7-dihydro-5H-1-benzothiophen-4-ide-2,3-diamine |
| SMILES | C[C-]1CCCc2sc(N)c(N)c21.[Ho] |
| InChI | InChI=1S/C9H13N2S.Ho/c1-5-3-2-4-6-7(5)8(10)9(11)12-6;/h2-4,10-11H2,1H3;/q-1; |
| InChIKey | NKLAXQGXNSFAMD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|