C16H22ClN3O2 — CID 162379363
N-[2-[(2R)-1-benzyl-4-(2-chloroacetyl)piperazin-2-yl]ethyl]formamide (PubChem CID 162379363) has the molecular formula C16H22ClN3O2 and a molecular weight of 323.82 g/mol. Its IUPAC name is N-[2-[(2R)-1-benzyl-4-(2-chloroacetyl)piperazin-2-yl]ethyl]formamide.
| Compound Name | N-[2-[(2R)-1-benzyl-4-(2-chloroacetyl)piperazin-2-yl]ethyl]formamide |
|---|---|
| PubChem CID | 162379363 |
| Molecular Formula | C16H22ClN3O2 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | N-[2-[(2R)-1-benzyl-4-(2-chloroacetyl)piperazin-2-yl]ethyl]formamide |
| SMILES | O=CNCC[C@@H]1CN(C(=O)CCl)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C16H22ClN3O2/c17-10-16(22)20-9-8-19(11-14-4-2-1-3-5-14)15(12-20)6-7-18-13-21/h1-5,13,15H,6-12H2,(H,18,21)/t15-/m1/s1 |
| InChIKey | WICFERCKKDCANN-OAHLLOKOSA-N |
| XLogP | 1.07 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|