C28H32F3N6O3+ — CID 162384779
2-[2-[[4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-fluoro-6-methylbenzoyl]amino]ethoxy]ethyl-trimethylazanium (PubChem CID 162384779) has the molecular formula C28H32F3N6O3+ and a molecular weight of 557.60 g/mol. Its IUPAC name is 2-[2-[[4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-fluoro-6-methylbenzoyl]amino]ethoxy]ethyl-trimethylazanium.
| Compound Name | 2-[2-[[4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-fluoro-6-methylbenzoyl]amino]ethoxy]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 162384779 |
| Molecular Formula | C28H32F3N6O3+ |
| Molecular Weight | 557.60 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | 2-[2-[[4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-fluoro-6-methylbenzoyl]amino]ethoxy]ethyl-trimethylazanium |
| SMILES | COc1ccc(-c2cnc3c(Nc4cc(C)c(C(=O)NCCOCC[N+](C)(C)C)c(F)c4)nccn23)c(F)c1F |
| InChI | InChI=1S/C28H31F3N6O3/c1-17-14-18(15-20(29)23(17)28(38)33-9-12-40-13-11-37(2,3)4)35-26-27-34-16-21(36(27)10-8-32-26)19-6-7-22(39-5)25(31)24(19)30/h6-8,10,14-16H,9,11-13H2,1-5H3,(H-,32,33,35,38)/p+1 |
| InChIKey | GRFMITWOXDZNJS-UHFFFAOYSA-O |
| XLogP | 4.33 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.60 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|