C3H7N2NaO4S — CID 162394147
sodium;(2R)-2-amino-3-sulfanylpropanoic acid;nitrite (PubChem CID 162394147) has the molecular formula C3H7N2NaO4S and a molecular weight of 190.16 g/mol. Its IUPAC name is sodium;(2R)-2-amino-3-sulfanylpropanoic acid;nitrite.
| Compound Name | sodium;(2R)-2-amino-3-sulfanylpropanoic acid;nitrite |
|---|---|
| PubChem CID | 162394147 |
| Molecular Formula | C3H7N2NaO4S |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.00 |
| IUPAC Name | sodium;(2R)-2-amino-3-sulfanylpropanoic acid;nitrite |
| SMILES | N[C@@H](CS)C(=O)O.O=N[O-].[Na+] |
| InChI | InChI=1S/C3H7NO2S.HNO2.Na/c4-2(1-7)3(5)6;2-1-3;/h2,7H,1,4H2,(H,5,6);(H,2,3);/q;;+1/p-1/t2-;;/m0../s1 |
| InChIKey | ODXZWDUPXFBLBD-JIZZDEOASA-M |
| XLogP | -3.42 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | -3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|