C36H34BF3NO5PS — CID 162405817
[triphenyl-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-pyridinyl]-λ5-phosphanyl] trifluoromethanesulfonate (PubChem CID 162405817) has the molecular formula C36H34BF3NO5PS and a molecular weight of 691.52 g/mol. Its IUPAC name is [triphenyl-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-pyridinyl]-λ5-phosphanyl] trifluoromethanesulfonate.
| Compound Name | [triphenyl-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-pyridinyl]-λ5-phosphanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 162405817 |
| Molecular Formula | C36H34BF3NO5PS |
| Molecular Weight | 691.52 g/mol |
| Exact Mass | 691.19 |
| IUPAC Name | [triphenyl-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-pyridinyl]-λ5-phosphanyl] trifluoromethanesulfonate |
| SMILES | CC1(C)OB(c2ccc(-c3cc(P(OS(=O)(=O)C(F)(F)F)(c4ccccc4)(c4ccccc4)c4ccccc4)ccn3)cc2)OC1(C)C |
| InChI | InChI=1S/C36H34BF3NO5PS/c1-34(2)35(3,4)45-37(44-34)28-22-20-27(21-23-28)33-26-32(24-25-41-33)47(29-14-8-5-9-15-29,30-16-10-6-11-17-30,31-18-12-7-13-19-31)46-48(42,43)36(38,39)40/h5-26H,1-4H3 |
| InChIKey | PISLWDOCXCFFPQ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.52 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|