C16H27NO5 — CID 162408097
ethyl 7-[(2-acetyloxyacetyl)amino]-4,4-dimethyl-2-methylideneheptanoate (PubChem CID 162408097) has the molecular formula C16H27NO5 and a molecular weight of 313.39 g/mol. Its IUPAC name is ethyl 7-[(2-acetyloxyacetyl)amino]-4,4-dimethyl-2-methylideneheptanoate.
| Compound Name | ethyl 7-[(2-acetyloxyacetyl)amino]-4,4-dimethyl-2-methylideneheptanoate |
|---|---|
| PubChem CID | 162408097 |
| Molecular Formula | C16H27NO5 |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | ethyl 7-[(2-acetyloxyacetyl)amino]-4,4-dimethyl-2-methylideneheptanoate |
| SMILES | C=C(CC(C)(C)CCCNC(=O)COC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C16H27NO5/c1-6-21-15(20)12(2)10-16(4,5)8-7-9-17-14(19)11-22-13(3)18/h2,6-11H2,1,3-5H3,(H,17,19) |
| InChIKey | LAXAYQULEWIJDQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|