C20H19NO3 — CID 162408813
3-butanoyl-1-methyl-4-phenyl-1-azaspiro[4.5]deca-3,6,9-triene-2,8-dione (PubChem CID 162408813) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is 3-butanoyl-1-methyl-4-phenyl-1-azaspiro[4.5]deca-3,6,9-triene-2,8-dione.
| Compound Name | 3-butanoyl-1-methyl-4-phenyl-1-azaspiro[4.5]deca-3,6,9-triene-2,8-dione |
|---|---|
| PubChem CID | 162408813 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 3-butanoyl-1-methyl-4-phenyl-1-azaspiro[4.5]deca-3,6,9-triene-2,8-dione |
| SMILES | CCCC(=O)C1=C(c2ccccc2)C2(C=CC(=O)C=C2)N(C)C1=O |
| InChI | InChI=1S/C20H19NO3/c1-3-7-16(23)17-18(14-8-5-4-6-9-14)20(21(2)19(17)24)12-10-15(22)11-13-20/h4-6,8-13H,3,7H2,1-2H3 |
| InChIKey | SHUFHWKKEDOVDH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|