C18H20O — CID 162409276
(E)-4,6-diphenylhex-5-en-1-ol (PubChem CID 162409276) has the molecular formula C18H20O and a molecular weight of 252.36 g/mol. Its IUPAC name is (E)-4,6-diphenylhex-5-en-1-ol.
| Compound Name | (E)-4,6-diphenylhex-5-en-1-ol |
|---|---|
| PubChem CID | 162409276 |
| Molecular Formula | C18H20O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | (E)-4,6-diphenylhex-5-en-1-ol |
| SMILES | OCCCC(/C=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H20O/c19-15-7-12-18(17-10-5-2-6-11-17)14-13-16-8-3-1-4-9-16/h1-6,8-11,13-14,18-19H,7,12,15H2/b14-13+ |
| InChIKey | RFNGUOYMQIHGJD-BUHFOSPRSA-N |
| XLogP | 4.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |