C10H18O2 — CID 162415505
2-[(2R,6S)-6-[(E)-prop-1-enyl]oxan-2-yl]ethanol (PubChem CID 162415505) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is 2-[(2R,6S)-6-[(E)-prop-1-enyl]oxan-2-yl]ethanol.
| Compound Name | 2-[(2R,6S)-6-[(E)-prop-1-enyl]oxan-2-yl]ethanol |
|---|---|
| PubChem CID | 162415505 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 2-[(2R,6S)-6-[(E)-prop-1-enyl]oxan-2-yl]ethanol |
| SMILES | C/C=C/[C@@H]1CCC[C@H](CCO)O1 |
| InChI | InChI=1S/C10H18O2/c1-2-4-9-5-3-6-10(12-9)7-8-11/h2,4,9-11H,3,5-8H2,1H3/b4-2+/t9-,10-/m1/s1 |
| InChIKey | LCPIDUCLLBXMBJ-QWZJGYIASA-N |
| XLogP | 1.88 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|