C14H16BrF2NO3 — CID 162415540
ethyl 4-acetamido-4-(4-bromophenyl)-2,2-difluorobutanoate (PubChem CID 162415540) has the molecular formula C14H16BrF2NO3 and a molecular weight of 364.19 g/mol. Its IUPAC name is ethyl 4-acetamido-4-(4-bromophenyl)-2,2-difluorobutanoate.
| Compound Name | ethyl 4-acetamido-4-(4-bromophenyl)-2,2-difluorobutanoate |
|---|---|
| PubChem CID | 162415540 |
| Molecular Formula | C14H16BrF2NO3 |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | ethyl 4-acetamido-4-(4-bromophenyl)-2,2-difluorobutanoate |
| SMILES | CCOC(=O)C(F)(F)CC(NC(C)=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H16BrF2NO3/c1-3-21-13(20)14(16,17)8-12(18-9(2)19)10-4-6-11(15)7-5-10/h4-7,12H,3,8H2,1-2H3,(H,18,19) |
| InChIKey | FRDOABREPQJMAW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |