C14H16ClF2NO3 — CID 162415543
ethyl (4R)-4-acetamido-4-(4-chlorophenyl)-2,2-difluorobutanoate (PubChem CID 162415543) has the molecular formula C14H16ClF2NO3 and a molecular weight of 319.74 g/mol. Its IUPAC name is ethyl (4R)-4-acetamido-4-(4-chlorophenyl)-2,2-difluorobutanoate.
| Compound Name | ethyl (4R)-4-acetamido-4-(4-chlorophenyl)-2,2-difluorobutanoate |
|---|---|
| PubChem CID | 162415543 |
| Molecular Formula | C14H16ClF2NO3 |
| Molecular Weight | 319.74 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | ethyl (4R)-4-acetamido-4-(4-chlorophenyl)-2,2-difluorobutanoate |
| SMILES | CCOC(=O)C(F)(F)C[C@@H](NC(C)=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H16ClF2NO3/c1-3-21-13(20)14(16,17)8-12(18-9(2)19)10-4-6-11(15)7-5-10/h4-7,12H,3,8H2,1-2H3,(H,18,19)/t12-/m1/s1 |
| InChIKey | FQWDMWOFSKVMDA-GFCCVEGCSA-N |
| XLogP | 3.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.74 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |