C24H27NO4S — CID 162415840
6-tert-butyl-3-methylidene-1-(4-methylphenyl)sulfonyl-2,6-dihydro-[1]benzofuro[2,3-c][1,5]oxazocine (PubChem CID 162415840) has the molecular formula C24H27NO4S and a molecular weight of 425.55 g/mol. Its IUPAC name is 6-tert-butyl-3-methylidene-1-(4-methylphenyl)sulfonyl-2,6-dihydro-[1]benzofuro[2,3-c][1,5]oxazocine.
| Compound Name | 6-tert-butyl-3-methylidene-1-(4-methylphenyl)sulfonyl-2,6-dihydro-[1]benzofuro[2,3-c][1,5]oxazocine |
|---|---|
| PubChem CID | 162415840 |
| Molecular Formula | C24H27NO4S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 6-tert-butyl-3-methylidene-1-(4-methylphenyl)sulfonyl-2,6-dihydro-[1]benzofuro[2,3-c][1,5]oxazocine |
| SMILES | C=C1COC(C(C)(C)C)c2oc3ccccc3c2N(S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C24H27NO4S/c1-16-10-12-18(13-11-16)30(26,27)25-14-17(2)15-28-23(24(3,4)5)22-21(25)19-8-6-7-9-20(19)29-22/h6-13,23H,2,14-15H2,1,3-5H3 |
| InChIKey | NWBVSJYRGFECFJ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|