C29H25NO2S — CID 162416222
4-methyl-N-[[2-[2-[2-(4-methylphenyl)ethynyl]phenyl]phenyl]methyl]benzenesulfonamide (PubChem CID 162416222) has the molecular formula C29H25NO2S and a molecular weight of 451.59 g/mol. Its IUPAC name is 4-methyl-N-[[2-[2-[2-(4-methylphenyl)ethynyl]phenyl]phenyl]methyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[[2-[2-[2-(4-methylphenyl)ethynyl]phenyl]phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 162416222 |
| Molecular Formula | C29H25NO2S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 4-methyl-N-[[2-[2-[2-(4-methylphenyl)ethynyl]phenyl]phenyl]methyl]benzenesulfonamide |
| SMILES | Cc1ccc(C#Cc2ccccc2-c2ccccc2CNS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C29H25NO2S/c1-22-11-15-24(16-12-22)17-18-25-7-3-5-9-28(25)29-10-6-4-8-26(29)21-30-33(31,32)27-19-13-23(2)14-20-27/h3-16,19-20,30H,21H2,1-2H3 |
| InChIKey | WLKYIDKTPUNYKU-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|