C4H11ClN2O2 — CID 162421567
2,2-dimethoxyethanimidamide;hydrochloride (PubChem CID 162421567) has the molecular formula C4H11ClN2O2 and a molecular weight of 154.60 g/mol. Its IUPAC name is 2,2-dimethoxyethanimidamide;hydrochloride.
| Compound Name | 2,2-dimethoxyethanimidamide;hydrochloride |
|---|---|
| PubChem CID | 162421567 |
| Molecular Formula | C4H11ClN2O2 |
| Molecular Weight | 154.60 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | 2,2-dimethoxyethanimidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)C(OC)OC |
| InChI | InChI=1S/C4H10N2O2.ClH/c1-7-4(8-2)3(5)6;/h4H,1-2H3,(H3,5,6);1H |
| InChIKey | LJRPGJDNJOXUFV-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.60 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|