C4H10N2O2 — CID 91755978
2,2-dimethoxyethanimidamide (PubChem CID 91755978) has the molecular formula C4H10N2O2 and a molecular weight of 118.14 g/mol. Its IUPAC name is 2,2-dimethoxyethanimidamide.
| Compound Name | 2,2-dimethoxyethanimidamide |
|---|---|
| PubChem CID | 91755978 |
| Molecular Formula | C4H10N2O2 |
| Molecular Weight | 118.14 g/mol |
| Exact Mass | 118.07 |
| IUPAC Name | 2,2-dimethoxyethanimidamide |
| SMILES | [H]/N=C(\N)C(OC)OC |
| InChI | InChI=1S/C4H10N2O2/c1-7-4(8-2)3(5)6/h4H,1-2H3,(H3,5,6) |
| InChIKey | GEFAWXQACXMZBX-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.14 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|