C13H24O3 — CID 162428529
2,5-dimethyl-3,6-dihydro-2H-pyran;2,5-dimethyl-1,3-dioxane (PubChem CID 162428529) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is 2,5-dimethyl-3,6-dihydro-2H-pyran;2,5-dimethyl-1,3-dioxane.
| Compound Name | 2,5-dimethyl-3,6-dihydro-2H-pyran;2,5-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 162428529 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 2,5-dimethyl-3,6-dihydro-2H-pyran;2,5-dimethyl-1,3-dioxane |
| SMILES | CC1=CCC(C)OC1.CC1COC(C)OC1 |
| InChI | InChI=1S/C7H12O.C6H12O2/c1-6-3-4-7(2)8-5-6;1-5-3-7-6(2)8-4-5/h3,7H,4-5H2,1-2H3;5-6H,3-4H2,1-2H3 |
| InChIKey | QCAKYYJQHYAEPP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|