C24H34N6 — CID 162431282
2-amino-5-[(R)-(4-amino-3-ethanimidoylanilino)-(6-methylcyclohex-3-en-1-yl)methyl]benzenecarboximidamide;methane (PubChem CID 162431282) has the molecular formula C24H34N6 and a molecular weight of 406.58 g/mol. Its IUPAC name is 2-amino-5-[(R)-(4-amino-3-ethanimidoylanilino)-(6-methylcyclohex-3-en-1-yl)methyl]benzenecarboximidamide;methane.
| Compound Name | 2-amino-5-[(R)-(4-amino-3-ethanimidoylanilino)-(6-methylcyclohex-3-en-1-yl)methyl]benzenecarboximidamide;methane |
|---|---|
| PubChem CID | 162431282 |
| Molecular Formula | C24H34N6 |
| Molecular Weight | 406.58 g/mol |
| Exact Mass | 406.28 |
| IUPAC Name | 2-amino-5-[(R)-(4-amino-3-ethanimidoylanilino)-(6-methylcyclohex-3-en-1-yl)methyl]benzenecarboximidamide;methane |
| SMILES | C.[H]/N=C(\N)c1cc([C@H](Nc2ccc(N)c(/C(C)=N/[H])c2)C2CC=CCC2C)ccc1N |
| InChI | InChI=1S/C23H30N6.CH4/c1-13-5-3-4-6-17(13)22(15-7-9-21(26)19(11-15)23(27)28)29-16-8-10-20(25)18(12-16)14(2)24;/h3-4,7-13,17,22,24,29H,5-6,25-26H2,1-2H3,(H3,27,28);1H4/b24-14+;/t13?,17?,22-;/m0./s1 |
| InChIKey | FOEMKBOIFOSJTB-ZLJJXKJPSA-N |
| XLogP | 4.91 |
| TPSA | 137.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|