C28H41FN4 — CID 162432203
1-N-[(Z)-[(4Z)-4-(3-cyclopropyl-5-fluorophenyl)-2-methylhepta-4,6-dien-3-ylidene]amino]-2-N-(1-ethylpiperidin-3-yl)-1-N-methylprop-2-ene-1,2-diamine (PubChem CID 162432203) has the molecular formula C28H41FN4 and a molecular weight of 452.66 g/mol. Its IUPAC name is 1-N-[(Z)-[(4Z)-4-(3-cyclopropyl-5-fluorophenyl)-2-methylhepta-4,6-dien-3-ylidene]amino]-2-N-(1-ethylpiperidin-3-yl)-1-N-methylprop-2-ene-1,2-diamine.
| Compound Name | 1-N-[(Z)-[(4Z)-4-(3-cyclopropyl-5-fluorophenyl)-2-methylhepta-4,6-dien-3-ylidene]amino]-2-N-(1-ethylpiperidin-3-yl)-1-N-methylprop-2-ene-1,2-diamine |
|---|---|
| PubChem CID | 162432203 |
| Molecular Formula | C28H41FN4 |
| Molecular Weight | 452.66 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | 1-N-[(Z)-[(4Z)-4-(3-cyclopropyl-5-fluorophenyl)-2-methylhepta-4,6-dien-3-ylidene]amino]-2-N-(1-ethylpiperidin-3-yl)-1-N-methylprop-2-ene-1,2-diamine |
| SMILES | C=C/C=C(C(=N/N(C)CC(=C)NC1CCCN(CC)C1)\C(C)C)/c1cc(F)cc(C2CC2)c1 |
| InChI | InChI=1S/C28H41FN4/c1-7-10-27(24-15-23(22-12-13-22)16-25(29)17-24)28(20(3)4)31-32(6)18-21(5)30-26-11-9-14-33(8-2)19-26/h7,10,15-17,20,22,26,30H,1,5,8-9,11-14,18-19H2,2-4,6H3/b27-10-,31-28- |
| InChIKey | GGWBYWDFYCMFCU-MZUNAJTGSA-N |
| XLogP | 5.80 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.66 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|