C16H22BN3O4S — CID 162432463
[6-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]thieno[3,2-c]pyridin-2-yl]boronic acid (PubChem CID 162432463) has the molecular formula C16H22BN3O4S and a molecular weight of 363.25 g/mol. Its IUPAC name is [6-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]thieno[3,2-c]pyridin-2-yl]boronic acid.
| Compound Name | [6-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]thieno[3,2-c]pyridin-2-yl]boronic acid |
|---|---|
| PubChem CID | 162432463 |
| Molecular Formula | C16H22BN3O4S |
| Molecular Weight | 363.25 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | [6-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]thieno[3,2-c]pyridin-2-yl]boronic acid |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cc3sc(B(O)O)cc3cn2)CC1 |
| InChI | InChI=1S/C16H22BN3O4S/c1-16(2,3)24-15(21)20-6-4-19(5-7-20)14-9-12-11(10-18-14)8-13(25-12)17(22)23/h8-10,22-23H,4-7H2,1-3H3 |
| InChIKey | SEHTXJYPAGOIOX-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 86.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|