C18H27ClN4O — CID 162435490
4-(azidomethyl)-1-[[3-chloro-4-(3-methylbutoxy)phenyl]methyl]piperidine (PubChem CID 162435490) has the molecular formula C18H27ClN4O and a molecular weight of 350.89 g/mol. Its IUPAC name is 4-(azidomethyl)-1-[[3-chloro-4-(3-methylbutoxy)phenyl]methyl]piperidine.
| Compound Name | 4-(azidomethyl)-1-[[3-chloro-4-(3-methylbutoxy)phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 162435490 |
| Molecular Formula | C18H27ClN4O |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 4-(azidomethyl)-1-[[3-chloro-4-(3-methylbutoxy)phenyl]methyl]piperidine |
| SMILES | CC(C)CCOc1ccc(CN2CCC(CN=[N+]=[N-])CC2)cc1Cl |
| InChI | InChI=1S/C18H27ClN4O/c1-14(2)7-10-24-18-4-3-16(11-17(18)19)13-23-8-5-15(6-9-23)12-21-22-20/h3-4,11,14-15H,5-10,12-13H2,1-2H3 |
| InChIKey | RUNSNXZTPIULBN-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 61.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|