C22H25ClFN5O2 — CID 162441574
(2E,3E)-3-amino-2-(aminomethylidene)-N-methylhexa-3,5-dienamide;6-(5-chloro-2-fluorophenyl)-8-methyl-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine (PubChem CID 162441574) has the molecular formula C22H25ClFN5O2 and a molecular weight of 445.93 g/mol. Its IUPAC name is (2E,3E)-3-amino-2-(aminomethylidene)-N-methylhexa-3,5-dienamide;6-(5-chloro-2-fluorophenyl)-8-methyl-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine.
| Compound Name | (2E,3E)-3-amino-2-(aminomethylidene)-N-methylhexa-3,5-dienamide;6-(5-chloro-2-fluorophenyl)-8-methyl-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine |
|---|---|
| PubChem CID | 162441574 |
| Molecular Formula | C22H25ClFN5O2 |
| Molecular Weight | 445.93 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | (2E,3E)-3-amino-2-(aminomethylidene)-N-methylhexa-3,5-dienamide;6-(5-chloro-2-fluorophenyl)-8-methyl-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine |
| SMILES | C=C/C=C(N)\C(=C/N)C(=O)NC.Cc1cc(-c2cc(Cl)ccc2F)nc2c1OCCN2 |
| InChI | InChI=1S/C14H12ClFN2O.C8H13N3O/c1-8-6-12(10-7-9(15)2-3-11(10)16)18-14-13(8)19-5-4-17-14;1-3-4-7(10)6(5-9)8(12)11-2/h2-3,6-7H,4-5H2,1H3,(H,17,18);3-5H,1,9-10H2,2H3,(H,11,12)/b;6-5+,7-4+ |
| InChIKey | NTNZGGYZSFNCCS-JAJJSRBKSA-N |
| XLogP | 3.26 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.93 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|