C24H27ClFN5O2 — CID 167135477
N-[(2E,4E)-4-[6-(5-chloro-2-fluorophenyl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-8-yl]-1-iminohexa-2,4-dien-2-yl]-4-(methylamino)butanamide (PubChem CID 167135477) has the molecular formula C24H27ClFN5O2 and a molecular weight of 471.96 g/mol. Its IUPAC name is N-[(2E,4E)-4-[6-(5-chloro-2-fluorophenyl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-8-yl]-1-iminohexa-2,4-dien-2-yl]-4-(methylamino)butanamide.
| Compound Name | N-[(2E,4E)-4-[6-(5-chloro-2-fluorophenyl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-8-yl]-1-iminohexa-2,4-dien-2-yl]-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 167135477 |
| Molecular Formula | C24H27ClFN5O2 |
| Molecular Weight | 471.96 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | N-[(2E,4E)-4-[6-(5-chloro-2-fluorophenyl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-8-yl]-1-iminohexa-2,4-dien-2-yl]-4-(methylamino)butanamide |
| SMILES | [H]/N=C/C(=C\C(=C/C)c1cc(-c2cc(Cl)ccc2F)nc2c1OCCN2)NC(=O)CCCNC |
| InChI | InChI=1S/C24H27ClFN5O2/c1-3-15(11-17(14-27)30-22(32)5-4-8-28-2)18-13-21(19-12-16(25)6-7-20(19)26)31-24-23(18)33-10-9-29-24/h3,6-7,11-14,27-28H,4-5,8-10H2,1-2H3,(H,29,31)(H,30,32)/b15-3+,17-11+,27-14+ |
| InChIKey | JPOWCHFNSOVTCX-YLKNCKFTSA-N |
| XLogP | 4.40 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.96 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|