C30H57IO4Si2 — CID 162445755
[(1E,3S,4S)-1-iodo-2,4-dimethylhexa-1,5-dien-3-yl] (3S)-3-[tert-butyl(dimethyl)silyl]oxy-6-methyl-6-triethylsilyloxynon-8-enoate (PubChem CID 162445755) has the molecular formula C30H57IO4Si2 and a molecular weight of 664.86 g/mol. Its IUPAC name is [(1E,3S,4S)-1-iodo-2,4-dimethylhexa-1,5-dien-3-yl] (3S)-3-[tert-butyl(dimethyl)silyl]oxy-6-methyl-6-triethylsilyloxynon-8-enoate.
| Compound Name | [(1E,3S,4S)-1-iodo-2,4-dimethylhexa-1,5-dien-3-yl] (3S)-3-[tert-butyl(dimethyl)silyl]oxy-6-methyl-6-triethylsilyloxynon-8-enoate |
|---|---|
| PubChem CID | 162445755 |
| Molecular Formula | C30H57IO4Si2 |
| Molecular Weight | 664.86 g/mol |
| Exact Mass | 664.28 |
| IUPAC Name | [(1E,3S,4S)-1-iodo-2,4-dimethylhexa-1,5-dien-3-yl] (3S)-3-[tert-butyl(dimethyl)silyl]oxy-6-methyl-6-triethylsilyloxynon-8-enoate |
| SMILES | C=CCC(C)(CC[C@@H](CC(=O)O[C@H](/C(C)=C/I)[C@@H](C)C=C)O[Si](C)(C)C(C)(C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C30H57IO4Si2/c1-14-20-30(11,35-37(16-3,17-4)18-5)21-19-26(34-36(12,13)29(8,9)10)22-27(32)33-28(24(6)15-2)25(7)23-31/h14-15,23-24,26,28H,1-2,16-22H2,3-13H3/b25-23+/t24-,26-,28-,30?/m0/s1 |
| InChIKey | WKDSKXQIQSGUCA-FCHVLHBZSA-N |
| XLogP | 9.98 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.86 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|