C22H39IO3Si — CID 155758296
(4R,7S,9Z,11S,12S)-4-[tert-butyl(dimethyl)silyl]oxy-12-[(E)-1-iodoprop-1-en-2-yl]-7,11-dimethyl-1-oxacyclododec-9-en-2-one (PubChem CID 155758296) has the molecular formula C22H39IO3Si and a molecular weight of 506.54 g/mol. Its IUPAC name is (4R,7S,9Z,11S,12S)-4-[tert-butyl(dimethyl)silyl]oxy-12-[(E)-1-iodoprop-1-en-2-yl]-7,11-dimethyl-1-oxacyclododec-9-en-2-one.
| Compound Name | (4R,7S,9Z,11S,12S)-4-[tert-butyl(dimethyl)silyl]oxy-12-[(E)-1-iodoprop-1-en-2-yl]-7,11-dimethyl-1-oxacyclododec-9-en-2-one |
|---|---|
| PubChem CID | 155758296 |
| Molecular Formula | C22H39IO3Si |
| Molecular Weight | 506.54 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | (4R,7S,9Z,11S,12S)-4-[tert-butyl(dimethyl)silyl]oxy-12-[(E)-1-iodoprop-1-en-2-yl]-7,11-dimethyl-1-oxacyclododec-9-en-2-one |
| SMILES | C/C(=C\I)[C@H]1OC(=O)C[C@H](O[Si](C)(C)C(C)(C)C)CC[C@H](C)C/C=C\[C@@H]1C |
| InChI | InChI=1S/C22H39IO3Si/c1-16-10-9-11-17(2)21(18(3)15-23)25-20(24)14-19(13-12-16)26-27(7,8)22(4,5)6/h9,11,15-17,19,21H,10,12-14H2,1-8H3/b11-9-,18-15+/t16-,17+,19-,21+/m1/s1 |
| InChIKey | DWPRVJUCMMKJIN-BAUYLITFSA-N |
| XLogP | 7.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.54 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|