C22H39IO5Si — CID 71492081
(4R,7R,8S,9E,11S,12S)-4-[tert-butyl(dimethyl)silyl]oxy-7,8-dihydroxy-12-[(E)-1-iodoprop-1-en-2-yl]-7,11-dimethyl-1-oxacyclododec-9-en-2-one (PubChem CID 71492081) has the molecular formula C22H39IO5Si and a molecular weight of 538.54 g/mol. Its IUPAC name is (4R,7R,8S,9E,11S,12S)-4-[tert-butyl(dimethyl)silyl]oxy-7,8-dihydroxy-12-[(E)-1-iodoprop-1-en-2-yl]-7,11-dimethyl-1-oxacyclododec-9-en-2-one.
| Compound Name | (4R,7R,8S,9E,11S,12S)-4-[tert-butyl(dimethyl)silyl]oxy-7,8-dihydroxy-12-[(E)-1-iodoprop-1-en-2-yl]-7,11-dimethyl-1-oxacyclododec-9-en-2-one |
|---|---|
| PubChem CID | 71492081 |
| Molecular Formula | C22H39IO5Si |
| Molecular Weight | 538.54 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | (4R,7R,8S,9E,11S,12S)-4-[tert-butyl(dimethyl)silyl]oxy-7,8-dihydroxy-12-[(E)-1-iodoprop-1-en-2-yl]-7,11-dimethyl-1-oxacyclododec-9-en-2-one |
| SMILES | C/C(=C\I)[C@H]1OC(=O)C[C@H](O[Si](C)(C)C(C)(C)C)CC[C@@](C)(O)[C@@H](O)/C=C/[C@@H]1C |
| InChI | InChI=1S/C22H39IO5Si/c1-15-9-10-18(24)22(6,26)12-11-17(28-29(7,8)21(3,4)5)13-19(25)27-20(15)16(2)14-23/h9-10,14-15,17-18,20,24,26H,11-13H2,1-8H3/b10-9+,16-14+/t15-,17+,18-,20-,22+/m0/s1 |
| InChIKey | JGWAREYEQLTEGK-HCACWJEBSA-N |
| XLogP | 5.12 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.54 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|