C17H14N4O3 — CID 162489117
N-(N-acetylcarbamimidoyl)-3-cyano-6-hydroxy-2-phenylbenzamide (PubChem CID 162489117) has the molecular formula C17H14N4O3 and a molecular weight of 322.32 g/mol. Its IUPAC name is N-(N-acetylcarbamimidoyl)-3-cyano-6-hydroxy-2-phenylbenzamide.
| Compound Name | N-(N-acetylcarbamimidoyl)-3-cyano-6-hydroxy-2-phenylbenzamide |
|---|---|
| PubChem CID | 162489117 |
| Molecular Formula | C17H14N4O3 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | N-(N-acetylcarbamimidoyl)-3-cyano-6-hydroxy-2-phenylbenzamide |
| SMILES | [H]/N=C(\NC(C)=O)NC(=O)c1c(O)ccc(C#N)c1-c1ccccc1 |
| InChI | InChI=1S/C17H14N4O3/c1-10(22)20-17(19)21-16(24)15-13(23)8-7-12(9-18)14(15)11-5-3-2-4-6-11/h2-8,23H,1H3,(H3,19,20,21,22,24) |
| InChIKey | MYUUOMMGSLMFQG-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|