C22H22N4O5 — CID 162489174
tert-butyl (NZ)-N-[acetamido-[(3-cyano-6-hydroxy-2-phenylbenzoyl)amino]methylidene]carbamate (PubChem CID 162489174) has the molecular formula C22H22N4O5 and a molecular weight of 422.44 g/mol. Its IUPAC name is tert-butyl (NZ)-N-[acetamido-[(3-cyano-6-hydroxy-2-phenylbenzoyl)amino]methylidene]carbamate.
| Compound Name | tert-butyl (NZ)-N-[acetamido-[(3-cyano-6-hydroxy-2-phenylbenzoyl)amino]methylidene]carbamate |
|---|---|
| PubChem CID | 162489174 |
| Molecular Formula | C22H22N4O5 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | tert-butyl (NZ)-N-[acetamido-[(3-cyano-6-hydroxy-2-phenylbenzoyl)amino]methylidene]carbamate |
| SMILES | CC(=O)N/C(=N/C(=O)OC(C)(C)C)NC(=O)c1c(O)ccc(C#N)c1-c1ccccc1 |
| InChI | InChI=1S/C22H22N4O5/c1-13(27)24-20(26-21(30)31-22(2,3)4)25-19(29)18-16(28)11-10-15(12-23)17(18)14-8-6-5-7-9-14/h5-11,28H,1-4H3,(H2,24,25,26,27,29,30) |
| InChIKey | YIKRMGRRJSNQKH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 140.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|