C20H20N4O5 — CID 158110377
tert-butyl N-[amino-[(6-hydroxy-3-isocyano-2-phenoxybenzoyl)amino]methylidene]carbamate (PubChem CID 158110377) has the molecular formula C20H20N4O5 and a molecular weight of 396.40 g/mol. Its IUPAC name is tert-butyl N-[amino-[(6-hydroxy-3-isocyano-2-phenoxybenzoyl)amino]methylidene]carbamate.
| Compound Name | tert-butyl N-[amino-[(6-hydroxy-3-isocyano-2-phenoxybenzoyl)amino]methylidene]carbamate |
|---|---|
| PubChem CID | 158110377 |
| Molecular Formula | C20H20N4O5 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | tert-butyl N-[amino-[(6-hydroxy-3-isocyano-2-phenoxybenzoyl)amino]methylidene]carbamate |
| SMILES | [C-]#[N+]c1ccc(O)c(C(=O)NC(N)=NC(=O)OC(C)(C)C)c1Oc1ccccc1 |
| InChI | InChI=1S/C20H20N4O5/c1-20(2,3)29-19(27)24-18(21)23-17(26)15-14(25)11-10-13(22-4)16(15)28-12-8-6-5-7-9-12/h5-11,25H,1-3H3,(H3,21,23,24,26,27) |
| InChIKey | FSCNFHXOVCJIJA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 127.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|