C26H31FN4O5 — CID 162489167
tert-butyl (NZ)-N-[amino-[[6-butoxy-2-(5-fluoro-2-methoxyphenyl)-3-isocyano-4-methylbenzoyl]amino]methylidene]carbamate (PubChem CID 162489167) has the molecular formula C26H31FN4O5 and a molecular weight of 498.56 g/mol. Its IUPAC name is tert-butyl (NZ)-N-[amino-[[6-butoxy-2-(5-fluoro-2-methoxyphenyl)-3-isocyano-4-methylbenzoyl]amino]methylidene]carbamate.
| Compound Name | tert-butyl (NZ)-N-[amino-[[6-butoxy-2-(5-fluoro-2-methoxyphenyl)-3-isocyano-4-methylbenzoyl]amino]methylidene]carbamate |
|---|---|
| PubChem CID | 162489167 |
| Molecular Formula | C26H31FN4O5 |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | tert-butyl (NZ)-N-[amino-[[6-butoxy-2-(5-fluoro-2-methoxyphenyl)-3-isocyano-4-methylbenzoyl]amino]methylidene]carbamate |
| SMILES | [C-]#[N+]c1c(C)cc(OCCCC)c(C(=O)N/C(N)=N\C(=O)OC(C)(C)C)c1-c1cc(F)ccc1OC |
| InChI | InChI=1S/C26H31FN4O5/c1-8-9-12-35-19-13-15(2)22(29-6)20(17-14-16(27)10-11-18(17)34-7)21(19)23(32)30-24(28)31-25(33)36-26(3,4)5/h10-11,13-14H,8-9,12H2,1-5,7H3,(H3,28,30,31,32,33) |
| InChIKey | WSSDXYBKTHQIJW-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|