C19H11N7OS2 — CID 162494526
5-isocyano-6-oxo-2-[[3-(2H-tetrazol-5-yl)phenyl]methylsulfanyl]-4-thiophen-2-yl-1H-pyridine-3-carbonitrile (PubChem CID 162494526) has the molecular formula C19H11N7OS2 and a molecular weight of 417.48 g/mol. Its IUPAC name is 5-isocyano-6-oxo-2-[[3-(2H-tetrazol-5-yl)phenyl]methylsulfanyl]-4-thiophen-2-yl-1H-pyridine-3-carbonitrile.
| Compound Name | 5-isocyano-6-oxo-2-[[3-(2H-tetrazol-5-yl)phenyl]methylsulfanyl]-4-thiophen-2-yl-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 162494526 |
| Molecular Formula | C19H11N7OS2 |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | 5-isocyano-6-oxo-2-[[3-(2H-tetrazol-5-yl)phenyl]methylsulfanyl]-4-thiophen-2-yl-1H-pyridine-3-carbonitrile |
| SMILES | [C-]#[N+]c1c(-c2cccs2)c(C#N)c(SCc2cccc(-c3nn[nH]n3)c2)[nH]c1=O |
| InChI | InChI=1S/C19H11N7OS2/c1-21-16-15(14-6-3-7-28-14)13(9-20)19(22-18(16)27)29-10-11-4-2-5-12(8-11)17-23-25-26-24-17/h2-8H,10H2,(H,22,27)(H,23,24,25,26) |
| InChIKey | ZELQALQMZSGYNL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 115.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|