C32H31N2O+ — CID 162505788
6-[1,5-dimethyl-4-(2-methylpropyl)pyridin-1-ium-2-yl]-7,9-dimethyl-4-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-1-carbonitrile (PubChem CID 162505788) has the molecular formula C32H31N2O+ and a molecular weight of 464.64 g/mol. Its IUPAC name is 6-[1,5-dimethyl-4-(2-methylpropyl)pyridin-1-ium-2-yl]-7,9-dimethyl-4-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-1-carbonitrile.
| Compound Name | 6-[1,5-dimethyl-4-(2-methylpropyl)pyridin-1-ium-2-yl]-7,9-dimethyl-4-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-1-carbonitrile |
|---|---|
| PubChem CID | 162505788 |
| Molecular Formula | C32H31N2O+ |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | 6-[1,5-dimethyl-4-(2-methylpropyl)pyridin-1-ium-2-yl]-7,9-dimethyl-4-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-1-carbonitrile |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc(C#N)c3c2oc2c(-c4cc(CC(C)C)c(C)c[n+]4C)c(C)cc(C)c23)c([2H])c1[2H] |
| InChI | InChI=1S/C32H31N2O/c1-19(2)14-25-16-27(34(6)18-22(25)5)28-20(3)15-21(4)29-30-24(17-33)12-13-26(31(30)35-32(28)29)23-10-8-7-9-11-23/h7-13,15-16,18-19H,14H2,1-6H3/q+1/i7D,8D,9D,10D,11D |
| InChIKey | FDDVGDTYRJBFET-RAGZBHKVSA-N |
| XLogP | 7.74 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|