C29H25N2O+ — CID 162505969
7,9-dimethyl-4-(2,3,4,5,6-pentadeuteriophenyl)-6-(1,4,5-trimethylpyridin-1-ium-2-yl)dibenzofuran-1-carbonitrile (PubChem CID 162505969) has the molecular formula C29H25N2O+ and a molecular weight of 422.56 g/mol. Its IUPAC name is 7,9-dimethyl-4-(2,3,4,5,6-pentadeuteriophenyl)-6-(1,4,5-trimethylpyridin-1-ium-2-yl)dibenzofuran-1-carbonitrile.
| Compound Name | 7,9-dimethyl-4-(2,3,4,5,6-pentadeuteriophenyl)-6-(1,4,5-trimethylpyridin-1-ium-2-yl)dibenzofuran-1-carbonitrile |
|---|---|
| PubChem CID | 162505969 |
| Molecular Formula | C29H25N2O+ |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 7,9-dimethyl-4-(2,3,4,5,6-pentadeuteriophenyl)-6-(1,4,5-trimethylpyridin-1-ium-2-yl)dibenzofuran-1-carbonitrile |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc(C#N)c3c2oc2c(-c4cc(C)c(C)c[n+]4C)c(C)cc(C)c23)c([2H])c1[2H] |
| InChI | InChI=1S/C29H25N2O/c1-17-14-24(31(5)16-20(17)4)25-18(2)13-19(3)26-27-22(15-30)11-12-23(28(27)32-29(25)26)21-9-7-6-8-10-21/h6-14,16H,1-5H3/q+1/i6D,7D,8D,9D,10D |
| InChIKey | TYGKMSMQDWEQNR-AITMVNPLSA-N |
| XLogP | 6.85 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|