C26H33N3O3 — CID 162506794
(8S)-8-amino-1-cyclobutyl-8-[5-(7-methoxy-2-methylquinolin-6-yl)-1,3-oxazol-2-yl]octan-2-one (PubChem CID 162506794) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is (8S)-8-amino-1-cyclobutyl-8-[5-(7-methoxy-2-methylquinolin-6-yl)-1,3-oxazol-2-yl]octan-2-one.
| Compound Name | (8S)-8-amino-1-cyclobutyl-8-[5-(7-methoxy-2-methylquinolin-6-yl)-1,3-oxazol-2-yl]octan-2-one |
|---|---|
| PubChem CID | 162506794 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | (8S)-8-amino-1-cyclobutyl-8-[5-(7-methoxy-2-methylquinolin-6-yl)-1,3-oxazol-2-yl]octan-2-one |
| SMILES | COc1cc2nc(C)ccc2cc1-c1cnc([C@@H](N)CCCCCC(=O)CC2CCC2)o1 |
| InChI | InChI=1S/C26H33N3O3/c1-17-11-12-19-14-21(24(31-2)15-23(19)29-17)25-16-28-26(32-25)22(27)10-5-3-4-9-20(30)13-18-7-6-8-18/h11-12,14-16,18,22H,3-10,13,27H2,1-2H3/t22-/m0/s1 |
| InChIKey | CSFDDSIZBWZGMU-QFIPXVFZSA-N |
| XLogP | 5.92 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|